C20H22F6N2O6S2 — CID 10816772
2,6,9,13-tetramethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene;bis(trifluoromethanesulfonate) (PubChem CID 10816772) has the molecular formula C20H22F6N2O6S2 and a molecular weight of 564.53 g/mol. Its IUPAC name is 2,6,9,13-tetramethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene;bis(trifluoromethanesulfonate).
| Compound Name | 2,6,9,13-tetramethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 10816772 |
| Molecular Formula | C20H22F6N2O6S2 |
| Molecular Weight | 564.53 g/mol |
| Exact Mass | 564.08 |
| IUPAC Name | 2,6,9,13-tetramethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene;bis(trifluoromethanesulfonate) |
| SMILES | CC1=CC2C=[N+](C)C3C=C(C)C=C4C=[N+](C)C(=C1)C2C43.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C18H22N2.2CHF3O3S/c1-11-5-13-9-20(4)16-8-12(2)6-14-10-19(3)15(7-11)17(13)18(14)16;2*2-1(3,4)8(5,6)7/h5-10,13,16-18H,1-4H3;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | LACHDVHNMDCBGB-UHFFFAOYSA-L |
| XLogP | 2.49 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|