C18H22N2+2 — CID 10647654
2,6,9,13-tetramethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene (PubChem CID 10647654) has the molecular formula C18H22N2+2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 2,6,9,13-tetramethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene.
| Compound Name | 2,6,9,13-tetramethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene |
|---|---|
| PubChem CID | 10647654 |
| Molecular Formula | C18H22N2+2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 2,6,9,13-tetramethyl-2,9-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene |
| SMILES | CC1=CC2C=[N+](C)C3C=C(C)C=C4C=[N+](C)C(=C1)C2C43 |
| InChI | InChI=1S/C18H22N2/c1-11-5-13-9-20(4)16-8-12(2)6-14-10-19(3)15(7-11)17(13)18(14)16/h5-10,13,16-18H,1-4H3/q+2 |
| InChIKey | PRDQQFLOVAZSLG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|