C26H50N2+2 — CID 90941773
[3-[[(3-ethyl-4,5-dimethylhex-1-en-2-yl)-methylazaniumylidene]methyl]-4,5-dimethylhepta-1,3-dien-2-yl]-dimethyl-propylazanium (PubChem CID 90941773) has the molecular formula C26H50N2+2 and a molecular weight of 390.70 g/mol. Its IUPAC name is [3-[[(3-ethyl-4,5-dimethylhex-1-en-2-yl)-methylazaniumylidene]methyl]-4,5-dimethylhepta-1,3-dien-2-yl]-dimethyl-propylazanium.
| Compound Name | [3-[[(3-ethyl-4,5-dimethylhex-1-en-2-yl)-methylazaniumylidene]methyl]-4,5-dimethylhepta-1,3-dien-2-yl]-dimethyl-propylazanium |
|---|---|
| PubChem CID | 90941773 |
| Molecular Formula | C26H50N2+2 |
| Molecular Weight | 390.70 g/mol |
| Exact Mass | 390.40 |
| IUPAC Name | [3-[[(3-ethyl-4,5-dimethylhex-1-en-2-yl)-methylazaniumylidene]methyl]-4,5-dimethylhepta-1,3-dien-2-yl]-dimethyl-propylazanium |
| SMILES | C=C(C(CC)C(C)C(C)C)/[N+](C)=C/C(C(=C)[N+](C)(C)CCC)=C(C)C(C)CC |
| InChI | InChI=1S/C26H50N2/c1-14-17-28(12,13)24(10)26(22(8)20(6)15-2)18-27(11)23(9)25(16-3)21(7)19(4)5/h18-21,25H,9-10,14-17H2,1-8,11-13H3/q+2/b26-22?,27-18+ |
| InChIKey | VFCDARPTAKEHBC-VOHNZXETSA-N |
| XLogP | 6.89 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.70 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|