C25H45N2+ — CID 91801880
[2-[1-(dimethylamino)ethenyl]-3,4-dimethylhex-2-enylidene]-propyl-[1-(2,3,4-trimethylcyclopentyl)ethenyl]azanium (PubChem CID 91801880) has the molecular formula C25H45N2+ and a molecular weight of 373.65 g/mol. Its IUPAC name is [2-[1-(dimethylamino)ethenyl]-3,4-dimethylhex-2-enylidene]-propyl-[1-(2,3,4-trimethylcyclopentyl)ethenyl]azanium.
| Compound Name | [2-[1-(dimethylamino)ethenyl]-3,4-dimethylhex-2-enylidene]-propyl-[1-(2,3,4-trimethylcyclopentyl)ethenyl]azanium |
|---|---|
| PubChem CID | 91801880 |
| Molecular Formula | C25H45N2+ |
| Molecular Weight | 373.65 g/mol |
| Exact Mass | 373.36 |
| IUPAC Name | [2-[1-(dimethylamino)ethenyl]-3,4-dimethylhex-2-enylidene]-propyl-[1-(2,3,4-trimethylcyclopentyl)ethenyl]azanium |
| SMILES | C=C(C(/C=[N+](\CCC)C(=C)C1CC(C)C(C)C1C)=C(C)C(C)CC)N(C)C |
| InChI | InChI=1S/C25H45N2/c1-12-14-27(23(9)24-15-18(4)19(5)21(24)7)16-25(22(8)26(10)11)20(6)17(3)13-2/h16-19,21,24H,8-9,12-15H2,1-7,10-11H3/q+1/b25-20?,27-16+ |
| InChIKey | XLBVOQVAQMHKDS-UHABCKSNSA-N |
| XLogP | 6.36 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|