C20H34N2 — CID 163230457
(Z)-N-(2-cyclopentylethyl)-N-ethyl-4-methyl-5-[(1E,3E)-penta-1,3-dienyl]iminopent-3-en-1-amine (PubChem CID 163230457) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is (Z)-N-(2-cyclopentylethyl)-N-ethyl-4-methyl-5-[(1E,3E)-penta-1,3-dienyl]iminopent-3-en-1-amine.
| Compound Name | (Z)-N-(2-cyclopentylethyl)-N-ethyl-4-methyl-5-[(1E,3E)-penta-1,3-dienyl]iminopent-3-en-1-amine |
|---|---|
| PubChem CID | 163230457 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | (Z)-N-(2-cyclopentylethyl)-N-ethyl-4-methyl-5-[(1E,3E)-penta-1,3-dienyl]iminopent-3-en-1-amine |
| SMILES | C/C=C/C=C/N=C/C(C)=C\CCN(CC)CCC1CCCC1 |
| InChI | InChI=1S/C20H34N2/c1-4-6-9-15-21-18-19(3)11-10-16-22(5-2)17-14-20-12-7-8-13-20/h4,6,9,11,15,18,20H,5,7-8,10,12-14,16-17H2,1-3H3/b6-4+,15-9+,19-11-,21-18+ |
| InChIKey | JSFHYLGRMQDPPY-KJBGPQPUSA-N |
| XLogP | 5.39 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|