C20H34N2 — CID 163488920
N,N-diethyl-4-[[(2Z)-2-ethylidene-4,4-dimethylpentyl]iminomethyl]cyclohexa-1,3-dien-1-amine (PubChem CID 163488920) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is N,N-diethyl-4-[[(2Z)-2-ethylidene-4,4-dimethylpentyl]iminomethyl]cyclohexa-1,3-dien-1-amine.
| Compound Name | N,N-diethyl-4-[[(2Z)-2-ethylidene-4,4-dimethylpentyl]iminomethyl]cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163488920 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | N,N-diethyl-4-[[(2Z)-2-ethylidene-4,4-dimethylpentyl]iminomethyl]cyclohexa-1,3-dien-1-amine |
| SMILES | C/C=C(\C/N=C/C1=CC=C(N(CC)CC)CC1)CC(C)(C)C |
| InChI | InChI=1S/C20H34N2/c1-7-17(14-20(4,5)6)15-21-16-18-10-12-19(13-11-18)22(8-2)9-3/h7,10,12,16H,8-9,11,13-15H2,1-6H3/b17-7-,21-16+ |
| InChIKey | CKXRWALJKRYHNW-OQDVRWDESA-N |
| XLogP | 5.39 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|