C15H22N2 — CID 143030224
(2E)-N,N-dimethyl-2-[3-(prop-1-en-2-yliminomethyl)buta-1,3-dien-2-yl]penta-2,4-dien-1-amine (PubChem CID 143030224) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (2E)-N,N-dimethyl-2-[3-(prop-1-en-2-yliminomethyl)buta-1,3-dien-2-yl]penta-2,4-dien-1-amine.
| Compound Name | (2E)-N,N-dimethyl-2-[3-(prop-1-en-2-yliminomethyl)buta-1,3-dien-2-yl]penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143030224 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (2E)-N,N-dimethyl-2-[3-(prop-1-en-2-yliminomethyl)buta-1,3-dien-2-yl]penta-2,4-dien-1-amine |
| SMILES | C=C/C=C(/CN(C)C)C(=C)C(=C)/C=N/C(=C)C |
| InChI | InChI=1S/C15H22N2/c1-8-9-15(11-17(6)7)14(5)13(4)10-16-12(2)3/h8-10H,1-2,4-5,11H2,3,6-7H3/b15-9-,16-10+ |
| InChIKey | VBUJHRASSNGJQL-CKOAPEAFSA-N |
| XLogP | 3.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|