C13H18N2 — CID 163386256
N,N-dimethyl-2-(5-methyl-4H-indol-3-yl)ethanamine (PubChem CID 163386256) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N,N-dimethyl-2-(5-methyl-4H-indol-3-yl)ethanamine.
| Compound Name | N,N-dimethyl-2-(5-methyl-4H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 163386256 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N,N-dimethyl-2-(5-methyl-4H-indol-3-yl)ethanamine |
| SMILES | CC1=CC=C2N=CC(CCN(C)C)=C2C1 |
| InChI | InChI=1S/C13H18N2/c1-10-4-5-13-12(8-10)11(9-14-13)6-7-15(2)3/h4-5,9H,6-8H2,1-3H3 |
| InChIKey | RFPUKMSCYMBRET-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |