C21H36N2 — CID 134288045
(3E,5E,7E,12Z)-N,6-diethyl-N,13-dimethyl-14-methyliminotetradeca-3,5,7,12-tetraen-3-amine (PubChem CID 134288045) has the molecular formula C21H36N2 and a molecular weight of 316.53 g/mol. Its IUPAC name is (3E,5E,7E,12Z)-N,6-diethyl-N,13-dimethyl-14-methyliminotetradeca-3,5,7,12-tetraen-3-amine.
| Compound Name | (3E,5E,7E,12Z)-N,6-diethyl-N,13-dimethyl-14-methyliminotetradeca-3,5,7,12-tetraen-3-amine |
|---|---|
| PubChem CID | 134288045 |
| Molecular Formula | C21H36N2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | (3E,5E,7E,12Z)-N,6-diethyl-N,13-dimethyl-14-methyliminotetradeca-3,5,7,12-tetraen-3-amine |
| SMILES | CCC(/C=C/CCC/C=C(C)\C=N\C)=C\C=C(/CC)N(C)CC |
| InChI | InChI=1S/C21H36N2/c1-7-20(16-17-21(8-2)23(6)9-3)15-13-11-10-12-14-19(4)18-22-5/h13-18H,7-12H2,1-6H3/b15-13+,19-14-,20-16+,21-17+,22-18+ |
| InChIKey | QQKROSAKWKLPPV-XUUVVUSBSA-N |
| XLogP | 5.94 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|