C13H24 — CID 54445642
2,9-dimethylundeca-3,8-diene (PubChem CID 54445642) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 2,9-dimethylundeca-3,8-diene.
| Compound Name | 2,9-dimethylundeca-3,8-diene |
|---|---|
| PubChem CID | 54445642 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 2,9-dimethylundeca-3,8-diene |
| SMILES | CCC(C)=CCCCC=CC(C)C |
| InChI | InChI=1S/C13H24/c1-5-13(4)11-9-7-6-8-10-12(2)3/h8,10-12H,5-7,9H2,1-4H3 |
| InChIKey | SEPAVHMSSKDVOJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|