C23H38N3+ — CID 163249315
[5-[[[(4Z,6E)-6-amino-3-methylideneocta-4,6-dienyl]-methylamino]methyl]-2-methylcyclohexa-2,4-dien-1-yl]methylidene-diethylazanium (PubChem CID 163249315) has the molecular formula C23H38N3+ and a molecular weight of 356.58 g/mol. Its IUPAC name is [5-[[[(4Z,6E)-6-amino-3-methylideneocta-4,6-dienyl]-methylamino]methyl]-2-methylcyclohexa-2,4-dien-1-yl]methylidene-diethylazanium.
| Compound Name | [5-[[[(4Z,6E)-6-amino-3-methylideneocta-4,6-dienyl]-methylamino]methyl]-2-methylcyclohexa-2,4-dien-1-yl]methylidene-diethylazanium |
|---|---|
| PubChem CID | 163249315 |
| Molecular Formula | C23H38N3+ |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.31 |
| IUPAC Name | [5-[[[(4Z,6E)-6-amino-3-methylideneocta-4,6-dienyl]-methylamino]methyl]-2-methylcyclohexa-2,4-dien-1-yl]methylidene-diethylazanium |
| SMILES | C=C(/C=C\C(N)=C/C)CCN(C)CC1=CC=C(C)C(C=[N+](CC)CC)C1 |
| InChI | InChI=1S/C23H38N3/c1-7-23(24)13-10-19(4)14-15-25(6)17-21-12-11-20(5)22(16-21)18-26(8-2)9-3/h7,10-13,18,22H,4,8-9,14-17,24H2,1-3,5-6H3/q+1/b13-10-,23-7+ |
| InChIKey | XYLNFXMGJORCGM-UPHXHBGMSA-N |
| XLogP | 4.30 |
| TPSA | 32.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|