C21H39N3 — CID 91241257
N,2-dimethyl-3-[(3Z)-4-[1-(2-methylpropyl)piperidin-4-yl]hepta-1,3-dien-3-yl]iminopropan-1-amine (PubChem CID 91241257) has the molecular formula C21H39N3 and a molecular weight of 333.56 g/mol. Its IUPAC name is N,2-dimethyl-3-[(3Z)-4-[1-(2-methylpropyl)piperidin-4-yl]hepta-1,3-dien-3-yl]iminopropan-1-amine.
| Compound Name | N,2-dimethyl-3-[(3Z)-4-[1-(2-methylpropyl)piperidin-4-yl]hepta-1,3-dien-3-yl]iminopropan-1-amine |
|---|---|
| PubChem CID | 91241257 |
| Molecular Formula | C21H39N3 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.31 |
| IUPAC Name | N,2-dimethyl-3-[(3Z)-4-[1-(2-methylpropyl)piperidin-4-yl]hepta-1,3-dien-3-yl]iminopropan-1-amine |
| SMILES | C=CC(/N=C/C(C)CNC)=C(\CCC)C1CCN(CC(C)C)CC1 |
| InChI | InChI=1S/C21H39N3/c1-7-9-20(21(8-2)23-15-18(5)14-22-6)19-10-12-24(13-11-19)16-17(3)4/h8,15,17-19,22H,2,7,9-14,16H2,1,3-6H3/b21-20-,23-15+ |
| InChIKey | LBUMCBHLTIUMGF-YOHVXWMKSA-N |
| XLogP | 4.52 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|