C26H49N3 — CID 143825821
ethane;3-N-[(Z)-3-(2-ethyliminoethyl)pent-3-enyl]-1-N-methyl-2-[(3Z)-6-methylhepta-1,3,5-trien-2-yl]hexane-1,3-diamine (PubChem CID 143825821) has the molecular formula C26H49N3 and a molecular weight of 403.70 g/mol. Its IUPAC name is ethane;3-N-[(Z)-3-(2-ethyliminoethyl)pent-3-enyl]-1-N-methyl-2-[(3Z)-6-methylhepta-1,3,5-trien-2-yl]hexane-1,3-diamine.
| Compound Name | ethane;3-N-[(Z)-3-(2-ethyliminoethyl)pent-3-enyl]-1-N-methyl-2-[(3Z)-6-methylhepta-1,3,5-trien-2-yl]hexane-1,3-diamine |
|---|---|
| PubChem CID | 143825821 |
| Molecular Formula | C26H49N3 |
| Molecular Weight | 403.70 g/mol |
| Exact Mass | 403.39 |
| IUPAC Name | ethane;3-N-[(Z)-3-(2-ethyliminoethyl)pent-3-enyl]-1-N-methyl-2-[(3Z)-6-methylhepta-1,3,5-trien-2-yl]hexane-1,3-diamine |
| SMILES | C=C(/C=C\C=C(C)C)C(CNC)C(CCC)NCC/C(=C/C)C/C=N/CC.CC |
| InChI | InChI=1S/C24H43N3.C2H6/c1-8-12-24(27-18-16-22(9-2)15-17-26-10-3)23(19-25-7)21(6)14-11-13-20(4)5;1-2/h9,11,13-14,17,23-25,27H,6,8,10,12,15-16,18-19H2,1-5,7H3;1-2H3/b14-11-,22-9+,26-17+; |
| InChIKey | NUJINYBUMUXOJB-HHIAHRMVSA-N |
| XLogP | 6.50 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.70 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|