C20H36N2 — CID 70378160
5-cycloundec-5-en-1-yl-1,4-diazacycloundec-11-ene (PubChem CID 70378160) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 5-cycloundec-5-en-1-yl-1,4-diazacycloundec-11-ene.
| Compound Name | 5-cycloundec-5-en-1-yl-1,4-diazacycloundec-11-ene |
|---|---|
| PubChem CID | 70378160 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 5-cycloundec-5-en-1-yl-1,4-diazacycloundec-11-ene |
| SMILES | C1=CCCCC(C2CCCCC/C=N\CCN2)CCCCC1 |
| InChI | InChI=1S/C20H36N2/c1-2-4-6-10-14-19(13-9-5-3-1)20-15-11-7-8-12-16-21-17-18-22-20/h1,3,16,19-20,22H,2,4-15,17-18H2/b3-1?,21-16- |
| InChIKey | XQXGPFVKHVLDAR-MJTNQEMSSA-N |
| XLogP | 5.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|