C19H38N4 — CID 91530227
2-N-[7-(ethylideneamino)-2-methyloctyl]-5-(methylideneamino)hept-6-ene-1,2-diamine (PubChem CID 91530227) has the molecular formula C19H38N4 and a molecular weight of 322.54 g/mol. Its IUPAC name is 2-N-[7-(ethylideneamino)-2-methyloctyl]-5-(methylideneamino)hept-6-ene-1,2-diamine.
| Compound Name | 2-N-[7-(ethylideneamino)-2-methyloctyl]-5-(methylideneamino)hept-6-ene-1,2-diamine |
|---|---|
| PubChem CID | 91530227 |
| Molecular Formula | C19H38N4 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.31 |
| IUPAC Name | 2-N-[7-(ethylideneamino)-2-methyloctyl]-5-(methylideneamino)hept-6-ene-1,2-diamine |
| SMILES | C=CC(CCC(CN)NCC(C)CCCCC(C)/N=C/C)N=C |
| InChI | InChI=1S/C19H38N4/c1-6-18(21-5)12-13-19(14-20)23-15-16(3)10-8-9-11-17(4)22-7-2/h6-7,16-19,23H,1,5,8-15,20H2,2-4H3/b22-7+ |
| InChIKey | KBLNZLKBCLJUMU-QPJQQBGISA-N |
| XLogP | 3.61 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|