C24H52N4 — CID 90819070
4-ethenyl-2-N-ethyl-5-N-[2-methyl-3-(methylamino)dodecyl]hexane-1,2,5-triamine (PubChem CID 90819070) has the molecular formula C24H52N4 and a molecular weight of 396.71 g/mol. Its IUPAC name is 4-ethenyl-2-N-ethyl-5-N-[2-methyl-3-(methylamino)dodecyl]hexane-1,2,5-triamine.
| Compound Name | 4-ethenyl-2-N-ethyl-5-N-[2-methyl-3-(methylamino)dodecyl]hexane-1,2,5-triamine |
|---|---|
| PubChem CID | 90819070 |
| Molecular Formula | C24H52N4 |
| Molecular Weight | 396.71 g/mol |
| Exact Mass | 396.42 |
| IUPAC Name | 4-ethenyl-2-N-ethyl-5-N-[2-methyl-3-(methylamino)dodecyl]hexane-1,2,5-triamine |
| SMILES | C=CC(CC(CN)NCC)C(C)NCC(C)C(CCCCCCCCC)NC |
| InChI | InChI=1S/C24H52N4/c1-7-10-11-12-13-14-15-16-24(26-6)20(4)19-28-21(5)22(8-2)17-23(18-25)27-9-3/h8,20-24,26-28H,2,7,9-19,25H2,1,3-6H3 |
| InChIKey | PJAMICVZDDVHCG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.71 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|