C21H45N5 — CID 123160559
5-N-ethyl-5-[[3-(ethylamino)propylideneamino]methyl]-1-N,10-N-dimethyl-3-methylidenedecane-1,5,10-triamine (PubChem CID 123160559) has the molecular formula C21H45N5 and a molecular weight of 367.63 g/mol. Its IUPAC name is 5-N-ethyl-5-[[3-(ethylamino)propylideneamino]methyl]-1-N,10-N-dimethyl-3-methylidenedecane-1,5,10-triamine.
| Compound Name | 5-N-ethyl-5-[[3-(ethylamino)propylideneamino]methyl]-1-N,10-N-dimethyl-3-methylidenedecane-1,5,10-triamine |
|---|---|
| PubChem CID | 123160559 |
| Molecular Formula | C21H45N5 |
| Molecular Weight | 367.63 g/mol |
| Exact Mass | 367.37 |
| IUPAC Name | 5-N-ethyl-5-[[3-(ethylamino)propylideneamino]methyl]-1-N,10-N-dimethyl-3-methylidenedecane-1,5,10-triamine |
| SMILES | C=C(CCNC)CC(CCCCCNC)(C/N=C/CCNCC)NCC |
| InChI | InChI=1S/C21H45N5/c1-6-24-15-11-16-25-19-21(26-7-2,13-9-8-10-14-22-4)18-20(3)12-17-23-5/h16,22-24,26H,3,6-15,17-19H2,1-2,4-5H3/b25-16+ |
| InChIKey | RFNQKOBGYDQNLI-PCLIKHOPSA-N |
| XLogP | 2.74 |
| TPSA | 60.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.63 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|