C20H40N2 — CID 143377856
(8R)-N-(6-imino-3-methylidenehexyl)-8-methyldodecan-4-amine (PubChem CID 143377856) has the molecular formula C20H40N2 and a molecular weight of 308.55 g/mol. Its IUPAC name is (8R)-N-(6-imino-3-methylidenehexyl)-8-methyldodecan-4-amine.
| Compound Name | (8R)-N-(6-imino-3-methylidenehexyl)-8-methyldodecan-4-amine |
|---|---|
| PubChem CID | 143377856 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | (8R)-N-(6-imino-3-methylidenehexyl)-8-methyldodecan-4-amine |
| SMILES | [H]/N=C/CCC(=C)CCNC(CCC)CCC[C@H](C)CCCC |
| InChI | InChI=1S/C20H40N2/c1-5-7-11-18(3)12-8-14-20(10-6-2)22-17-15-19(4)13-9-16-21/h16,18,20-22H,4-15,17H2,1-3H3/b21-16+/t18-,20?/m1/s1 |
| InChIKey | XNVMNXLLJGNOSU-CZIMWQFISA-N |
| XLogP | 6.12 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|