C28H54N2 — CID 123367181
2-ethyl-N-(3-imino-4-methylpentyl)-7,12,16-trimethylheptadeca-11,15-dien-1-amine (PubChem CID 123367181) has the molecular formula C28H54N2 and a molecular weight of 418.75 g/mol. Its IUPAC name is 2-ethyl-N-(3-imino-4-methylpentyl)-7,12,16-trimethylheptadeca-11,15-dien-1-amine.
| Compound Name | 2-ethyl-N-(3-imino-4-methylpentyl)-7,12,16-trimethylheptadeca-11,15-dien-1-amine |
|---|---|
| PubChem CID | 123367181 |
| Molecular Formula | C28H54N2 |
| Molecular Weight | 418.75 g/mol |
| Exact Mass | 418.43 |
| IUPAC Name | 2-ethyl-N-(3-imino-4-methylpentyl)-7,12,16-trimethylheptadeca-11,15-dien-1-amine |
| SMILES | [H]/N=C(/CCNCC(CC)CCCCC(C)CCCC=C(C)CCC=C(C)C)C(C)C |
| InChI | InChI=1S/C28H54N2/c1-8-27(22-30-21-20-28(29)24(4)5)19-12-11-17-25(6)15-9-10-16-26(7)18-13-14-23(2)3/h14,16,24-25,27,29-30H,8-13,15,17-22H2,1-7H3/b26-16?,29-28- |
| InChIKey | ZXRNGHUGTNSAPF-YLXWNLCKSA-N |
| XLogP | 8.73 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.75 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|