C22H40N2 — CID 91393172
3-(cycloundecen-1-yl)-2-iminocycloundecan-1-amine (PubChem CID 91393172) has the molecular formula C22H40N2 and a molecular weight of 332.58 g/mol. Its IUPAC name is 3-(cycloundecen-1-yl)-2-iminocycloundecan-1-amine.
| Compound Name | 3-(cycloundecen-1-yl)-2-iminocycloundecan-1-amine |
|---|---|
| PubChem CID | 91393172 |
| Molecular Formula | C22H40N2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.32 |
| IUPAC Name | 3-(cycloundecen-1-yl)-2-iminocycloundecan-1-amine |
| SMILES | [H]/N=C1\C(N)CCCCCCCCC1C1=CCCCCCCCCC1 |
| InChI | InChI=1S/C22H40N2/c23-21-18-14-10-6-5-9-13-17-20(22(21)24)19-15-11-7-3-1-2-4-8-12-16-19/h15,20-21,24H,1-14,16-18,23H2/b19-15?,24-22- |
| InChIKey | JXSMUXGDJRPFGS-REVUAPRYSA-N |
| XLogP | 6.53 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|