C12H24N2 — CID 91580309
8-imino-7,9-dimethyldec-9-en-2-amine (PubChem CID 91580309) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 8-imino-7,9-dimethyldec-9-en-2-amine.
| Compound Name | 8-imino-7,9-dimethyldec-9-en-2-amine |
|---|---|
| PubChem CID | 91580309 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 8-imino-7,9-dimethyldec-9-en-2-amine |
| SMILES | [H]/N=C(\C(=C)C)C(C)CCCCC(C)N |
| InChI | InChI=1S/C12H24N2/c1-9(2)12(14)10(3)7-5-6-8-11(4)13/h10-11,14H,1,5-8,13H2,2-4H3/b14-12+ |
| InChIKey | KRHJLYBDYJDHSR-WYMLVPIESA-N |
| XLogP | 3.13 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|