C17H31N3 — CID 123172137
7-ethanimidoyl-6-(2-methylprop-2-enimidoyl)undec-9-en-1-amine (PubChem CID 123172137) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is 7-ethanimidoyl-6-(2-methylprop-2-enimidoyl)undec-9-en-1-amine.
| Compound Name | 7-ethanimidoyl-6-(2-methylprop-2-enimidoyl)undec-9-en-1-amine |
|---|---|
| PubChem CID | 123172137 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | 7-ethanimidoyl-6-(2-methylprop-2-enimidoyl)undec-9-en-1-amine |
| SMILES | [H]/N=C(\C(=C)C)C(CCCCCN)C(CC=CC)/C(C)=N/[H] |
| InChI | InChI=1S/C17H31N3/c1-5-6-10-15(14(4)19)16(17(20)13(2)3)11-8-7-9-12-18/h5-6,15-16,19-20H,2,7-12,18H2,1,3-4H3/b6-5?,19-14+,20-17+ |
| InChIKey | NBTPCGUSCNVVIO-MMINTSMZSA-N |
| XLogP | 4.34 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|