C15H28N2 — CID 90917683
(7Z)-7-ethylidene-2,3,8-trimethyldecane-1,6-diimine (PubChem CID 90917683) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is (7Z)-7-ethylidene-2,3,8-trimethyldecane-1,6-diimine.
| Compound Name | (7Z)-7-ethylidene-2,3,8-trimethyldecane-1,6-diimine |
|---|---|
| PubChem CID | 90917683 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | (7Z)-7-ethylidene-2,3,8-trimethyldecane-1,6-diimine |
| SMILES | [H]/N=C/C(C)C(C)CCC(=N\[H])/C(=C\C)C(C)CC |
| InChI | InChI=1S/C15H28N2/c1-6-11(3)14(7-2)15(17)9-8-12(4)13(5)10-16/h7,10-13,16-17H,6,8-9H2,1-5H3/b14-7-,16-10+,17-15+ |
| InChIKey | ULDRAMOZTMWDIG-HBQSHPITSA-N |
| XLogP | 4.70 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|