C13H21N — CID 91224376
2-[(1Z)-4-ethyl-8-methylcycloocta-1,3-dien-1-yl]ethanimine (PubChem CID 91224376) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 2-[(1Z)-4-ethyl-8-methylcycloocta-1,3-dien-1-yl]ethanimine.
| Compound Name | 2-[(1Z)-4-ethyl-8-methylcycloocta-1,3-dien-1-yl]ethanimine |
|---|---|
| PubChem CID | 91224376 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 2-[(1Z)-4-ethyl-8-methylcycloocta-1,3-dien-1-yl]ethanimine |
| SMILES | [H]/N=C/C/C1=C/C=C(CC)CCCC1C |
| InChI | InChI=1S/C13H21N/c1-3-12-6-4-5-11(2)13(8-7-12)9-10-14/h7-8,10-11,14H,3-6,9H2,1-2H3/b12-7?,13-8-,14-10+ |
| InChIKey | ZABWNJBSEKYKSN-PJAPGUFOSA-N |
| XLogP | 4.11 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|