C15H27N — CID 91253847
2,6,6,9-tetramethylundeca-7,9-dien-1-imine (PubChem CID 91253847) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 2,6,6,9-tetramethylundeca-7,9-dien-1-imine.
| Compound Name | 2,6,6,9-tetramethylundeca-7,9-dien-1-imine |
|---|---|
| PubChem CID | 91253847 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 2,6,6,9-tetramethylundeca-7,9-dien-1-imine |
| SMILES | [H]/N=C/C(C)CCCC(C)(C)C=CC(C)=CC |
| InChI | InChI=1S/C15H27N/c1-6-13(2)9-11-15(4,5)10-7-8-14(3)12-16/h6,9,11-12,14,16H,7-8,10H2,1-5H3/b11-9?,13-6?,16-12+ |
| InChIKey | XBLRKSFFGMIDOR-ZOIHXGQESA-N |
| XLogP | 4.99 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|