C15H26N2 — CID 91394984
1-N-butan-2-yl-6-ethyl-4,5-dimethylcyclohept-3-ene-1,2-diimine (PubChem CID 91394984) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-N-butan-2-yl-6-ethyl-4,5-dimethylcyclohept-3-ene-1,2-diimine.
| Compound Name | 1-N-butan-2-yl-6-ethyl-4,5-dimethylcyclohept-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 91394984 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-N-butan-2-yl-6-ethyl-4,5-dimethylcyclohept-3-ene-1,2-diimine |
| SMILES | [H]/N=C1\C=C(C)C(C)C(CC)C\C1=N/C(C)CC |
| InChI | InChI=1S/C15H26N2/c1-6-11(4)17-15-9-13(7-2)12(5)10(3)8-14(15)16/h8,11-13,16H,6-7,9H2,1-5H3/b16-14+,17-15+ |
| InChIKey | AKEFWAZGDXVJDD-YXLFCKQPSA-N |
| XLogP | 4.26 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|