C15H30N2 — CID 91397502
(4,8,10-trimethylundec-8-en-3-ylideneamino)methanamine (PubChem CID 91397502) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is (4,8,10-trimethylundec-8-en-3-ylideneamino)methanamine.
| Compound Name | (4,8,10-trimethylundec-8-en-3-ylideneamino)methanamine |
|---|---|
| PubChem CID | 91397502 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | (4,8,10-trimethylundec-8-en-3-ylideneamino)methanamine |
| SMILES | CCC(=NCN)C(C)CCCC(C)=CC(C)C |
| InChI | InChI=1S/C15H30N2/c1-6-15(17-11-16)14(5)9-7-8-13(4)10-12(2)3/h10,12,14H,6-9,11,16H2,1-5H3 |
| InChIKey | CUEVCXWZBBGFJP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|