C12H22N2 — CID 123353686
2-N,3-dimethyl-7-methylidenenonane-2,4-diimine (PubChem CID 123353686) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 2-N,3-dimethyl-7-methylidenenonane-2,4-diimine.
| Compound Name | 2-N,3-dimethyl-7-methylidenenonane-2,4-diimine |
|---|---|
| PubChem CID | 123353686 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 2-N,3-dimethyl-7-methylidenenonane-2,4-diimine |
| SMILES | [H]/N=C(\CCC(=C)CC)C(C)/C(C)=N/C |
| InChI | InChI=1S/C12H22N2/c1-6-9(2)7-8-12(13)10(3)11(4)14-5/h10,13H,2,6-8H2,1,3-5H3/b13-12+,14-11+ |
| InChIKey | XZJDFKVTNQGTPQ-UIGAKZAYSA-N |
| XLogP | 3.48 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|