C14H26N2 — CID 91435545
4-N-butan-2-yl-6,7-dimethyloct-7-ene-3,4-diimine (PubChem CID 91435545) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 4-N-butan-2-yl-6,7-dimethyloct-7-ene-3,4-diimine.
| Compound Name | 4-N-butan-2-yl-6,7-dimethyloct-7-ene-3,4-diimine |
|---|---|
| PubChem CID | 91435545 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 4-N-butan-2-yl-6,7-dimethyloct-7-ene-3,4-diimine |
| SMILES | [H]/N=C(CC)/C(CC(C)C(=C)C)=N\C(C)CC |
| InChI | InChI=1S/C14H26N2/c1-7-12(6)16-14(13(15)8-2)9-11(5)10(3)4/h11-12,15H,3,7-9H2,1-2,4-6H3/b15-13+,16-14- |
| InChIKey | AVSLWODDJAAABI-ZNOBWPMYSA-N |
| XLogP | 4.26 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|