C16H26N2 — CID 123185703
(4Z)-3-N,6,11-trimethyl-10-methylidenedodeca-4,11-diene-2,3-diimine (PubChem CID 123185703) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (4Z)-3-N,6,11-trimethyl-10-methylidenedodeca-4,11-diene-2,3-diimine.
| Compound Name | (4Z)-3-N,6,11-trimethyl-10-methylidenedodeca-4,11-diene-2,3-diimine |
|---|---|
| PubChem CID | 123185703 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (4Z)-3-N,6,11-trimethyl-10-methylidenedodeca-4,11-diene-2,3-diimine |
| SMILES | [H]/N=C(C)/C(/C=C\C(C)CCCC(=C)C(=C)C)=N\C |
| InChI | InChI=1S/C16H26N2/c1-12(2)14(4)9-7-8-13(3)10-11-16(18-6)15(5)17/h10-11,13,17H,1,4,7-9H2,2-3,5-6H3/b11-10-,17-15+,18-16- |
| InChIKey | GYPFADVTIKQQCJ-BBEDYLLDSA-N |
| XLogP | 4.59 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|