C24H41N — CID 90720795
(4E)-5-ethyl-7,9,13,16-tetramethyl-8-methylideneheptadeca-4,11,13-trien-2-imine (PubChem CID 90720795) has the molecular formula C24H41N and a molecular weight of 343.60 g/mol. Its IUPAC name is (4E)-5-ethyl-7,9,13,16-tetramethyl-8-methylideneheptadeca-4,11,13-trien-2-imine.
| Compound Name | (4E)-5-ethyl-7,9,13,16-tetramethyl-8-methylideneheptadeca-4,11,13-trien-2-imine |
|---|---|
| PubChem CID | 90720795 |
| Molecular Formula | C24H41N |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 343.32 |
| IUPAC Name | (4E)-5-ethyl-7,9,13,16-tetramethyl-8-methylideneheptadeca-4,11,13-trien-2-imine |
| SMILES | [H]/N=C(\C)C/C=C(\CC)CC(C)C(=C)C(C)CC=CC(C)=CCC(C)C |
| InChI | InChI=1S/C24H41N/c1-9-24(16-15-22(7)25)17-21(6)23(8)20(5)12-10-11-19(4)14-13-18(2)3/h10-11,14,16,18,20-21,25H,8-9,12-13,15,17H2,1-7H3/b11-10?,19-14?,24-16+,25-22+ |
| InChIKey | DMKHNGZREKKJCJ-LOEHRLCPSA-N |
| XLogP | 7.91 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|