C19H26F5N — CID 91463138
8-ethenyl-2,4-difluoro-5,12-dimethyl-3-(trifluoromethyl)tetradeca-2,4,7-trien-6-imine (PubChem CID 91463138) has the molecular formula C19H26F5N and a molecular weight of 363.41 g/mol. Its IUPAC name is 8-ethenyl-2,4-difluoro-5,12-dimethyl-3-(trifluoromethyl)tetradeca-2,4,7-trien-6-imine.
| Compound Name | 8-ethenyl-2,4-difluoro-5,12-dimethyl-3-(trifluoromethyl)tetradeca-2,4,7-trien-6-imine |
|---|---|
| PubChem CID | 91463138 |
| Molecular Formula | C19H26F5N |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 8-ethenyl-2,4-difluoro-5,12-dimethyl-3-(trifluoromethyl)tetradeca-2,4,7-trien-6-imine |
| SMILES | [H]/N=C(\C=C(C=C)CCCC(C)CC)C(C)=C(F)C(=C(C)F)C(F)(F)F |
| InChI | InChI=1S/C19H26F5N/c1-6-12(3)9-8-10-15(7-2)11-16(25)13(4)18(21)17(14(5)20)19(22,23)24/h7,11-12,25H,2,6,8-10H2,1,3-5H3/b15-11?,17-14?,18-13?,25-16+ |
| InChIKey | YWNJHLFCYRLZLP-FEXLARDISA-N |
| XLogP | 7.38 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|