C17H19F2N — CID 163505329
(2Z)-1-[4,6-difluoro-6-methyl-2-(1-methyl-2-methylidenecyclopropyl)cyclohexa-2,4-dien-1-yl]penta-2,4-dien-1-imine (PubChem CID 163505329) has the molecular formula C17H19F2N and a molecular weight of 275.34 g/mol. Its IUPAC name is (2Z)-1-[4,6-difluoro-6-methyl-2-(1-methyl-2-methylidenecyclopropyl)cyclohexa-2,4-dien-1-yl]penta-2,4-dien-1-imine.
| Compound Name | (2Z)-1-[4,6-difluoro-6-methyl-2-(1-methyl-2-methylidenecyclopropyl)cyclohexa-2,4-dien-1-yl]penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 163505329 |
| Molecular Formula | C17H19F2N |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (2Z)-1-[4,6-difluoro-6-methyl-2-(1-methyl-2-methylidenecyclopropyl)cyclohexa-2,4-dien-1-yl]penta-2,4-dien-1-imine |
| SMILES | [H]/N=C(\C=C/C=C)C1C(C2(C)CC2=C)=CC(F)=CC1(C)F |
| InChI | InChI=1S/C17H19F2N/c1-5-6-7-14(20)15-13(16(3)9-11(16)2)8-12(18)10-17(15,4)19/h5-8,10,15,20H,1-2,9H2,3-4H3/b7-6-,20-14+ |
| InChIKey | CYCNYTOZIXWJBA-VIXILHFFSA-N |
| XLogP | 4.85 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|