C19H24BrF2N — CID 135227362
5-[3-bromo-5-[1-(difluoromethyl)cyclopropyl]cyclohexa-1,3-dien-1-yl]-7-methylocta-1,7-dien-3-imine (PubChem CID 135227362) has the molecular formula C19H24BrF2N and a molecular weight of 384.31 g/mol. Its IUPAC name is 5-[3-bromo-5-[1-(difluoromethyl)cyclopropyl]cyclohexa-1,3-dien-1-yl]-7-methylocta-1,7-dien-3-imine.
| Compound Name | 5-[3-bromo-5-[1-(difluoromethyl)cyclopropyl]cyclohexa-1,3-dien-1-yl]-7-methylocta-1,7-dien-3-imine |
|---|---|
| PubChem CID | 135227362 |
| Molecular Formula | C19H24BrF2N |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 5-[3-bromo-5-[1-(difluoromethyl)cyclopropyl]cyclohexa-1,3-dien-1-yl]-7-methylocta-1,7-dien-3-imine |
| SMILES | [H]/N=C(\C=C)CC(CC(=C)C)C1=CC(Br)=CC(C2(C(F)F)CC2)C1 |
| InChI | InChI=1S/C19H24BrF2N/c1-4-17(23)10-13(7-12(2)3)14-8-15(11-16(20)9-14)19(5-6-19)18(21)22/h4,9,11,13,15,18,23H,1-2,5-8,10H2,3H3/b23-17+ |
| InChIKey | NCFKXVBGQJEXDE-HAVVHWLPSA-N |
| XLogP | 6.44 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|