C16H17F2N — CID 144782000
(6Z,8Z)-2,4-difluoro-6-methyl-10-propylidene-1,10a-dihydrobenzo[8]annulen-5-imine (PubChem CID 144782000) has the molecular formula C16H17F2N and a molecular weight of 261.31 g/mol. Its IUPAC name is (6Z,8Z)-2,4-difluoro-6-methyl-10-propylidene-1,10a-dihydrobenzo[8]annulen-5-imine.
| Compound Name | (6Z,8Z)-2,4-difluoro-6-methyl-10-propylidene-1,10a-dihydrobenzo[8]annulen-5-imine |
|---|---|
| PubChem CID | 144782000 |
| Molecular Formula | C16H17F2N |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (6Z,8Z)-2,4-difluoro-6-methyl-10-propylidene-1,10a-dihydrobenzo[8]annulen-5-imine |
| SMILES | [H]/N=C1C2=C(F)C=C(F)CC2C(=CCC)/C=C\C=C/1C |
| InChI | InChI=1S/C16H17F2N/c1-3-5-11-7-4-6-10(2)16(19)15-13(11)8-12(17)9-14(15)18/h4-7,9,13,19H,3,8H2,1-2H3/b7-4-,10-6-,11-5?,19-16+ |
| InChIKey | RBOXGPQDYKJKTG-VMVKPCLOSA-N |
| XLogP | 4.96 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|