C13H17FN2 — CID 142522965
3-fluoro-4-(iminomethylidene)-2,6-di(propan-2-yl)cyclohexa-2,5-dien-1-imine (PubChem CID 142522965) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 3-fluoro-4-(iminomethylidene)-2,6-di(propan-2-yl)cyclohexa-2,5-dien-1-imine.
| Compound Name | 3-fluoro-4-(iminomethylidene)-2,6-di(propan-2-yl)cyclohexa-2,5-dien-1-imine |
|---|---|
| PubChem CID | 142522965 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 3-fluoro-4-(iminomethylidene)-2,6-di(propan-2-yl)cyclohexa-2,5-dien-1-imine |
| SMILES | [H]/N=C1\C(C(C)C)=CC(=C=N)C(F)=C1C(C)C |
| InChI | InChI=1S/C13H17FN2/c1-7(2)10-5-9(6-15)12(14)11(8(3)4)13(10)16/h5,7-8,15-16H,1-4H3/b16-13+ |
| InChIKey | SNWKNTPIHOMKKR-DTQAZKPQSA-N |
| XLogP | 3.66 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|