C20H30FN — CID 142313967
butane;(6Z,8Z)-10-ethyl-2-fluoro-4,6-dimethyl-10,10a-dihydro-1H-benzo[8]annulen-5-imine (PubChem CID 142313967) has the molecular formula C20H30FN and a molecular weight of 303.47 g/mol. Its IUPAC name is butane;(6Z,8Z)-10-ethyl-2-fluoro-4,6-dimethyl-10,10a-dihydro-1H-benzo[8]annulen-5-imine.
| Compound Name | butane;(6Z,8Z)-10-ethyl-2-fluoro-4,6-dimethyl-10,10a-dihydro-1H-benzo[8]annulen-5-imine |
|---|---|
| PubChem CID | 142313967 |
| Molecular Formula | C20H30FN |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | butane;(6Z,8Z)-10-ethyl-2-fluoro-4,6-dimethyl-10,10a-dihydro-1H-benzo[8]annulen-5-imine |
| SMILES | CCCC.[H]/N=C1C2=C(C)C=C(F)CC2C(CC)/C=C\C=C/1C |
| InChI | InChI=1S/C16H20FN.C4H10/c1-4-12-7-5-6-10(2)16(18)15-11(3)8-13(17)9-14(12)15;1-3-4-2/h5-8,12,14,18H,4,9H2,1-3H3;3-4H2,1-2H3/b7-5-,10-6-,18-16+; |
| InChIKey | XGFBGIAVELGSAM-UABADDMJSA-N |
| XLogP | 6.54 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|