C14H24FN — CID 123799788
9-fluoro-5,7-dimethyldodeca-7,9-dien-4-imine (PubChem CID 123799788) has the molecular formula C14H24FN and a molecular weight of 225.35 g/mol. Its IUPAC name is 9-fluoro-5,7-dimethyldodeca-7,9-dien-4-imine.
| Compound Name | 9-fluoro-5,7-dimethyldodeca-7,9-dien-4-imine |
|---|---|
| PubChem CID | 123799788 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | 9-fluoro-5,7-dimethyldodeca-7,9-dien-4-imine |
| SMILES | [H]/N=C(\CCC)C(C)CC(C)=CC(F)=CCC |
| InChI | InChI=1S/C14H24FN/c1-5-7-13(15)10-11(3)9-12(4)14(16)8-6-2/h7,10,12,16H,5-6,8-9H2,1-4H3/b11-10?,13-7?,16-14+ |
| InChIKey | OXQHWSOQEAXKKR-JPNODBDPSA-N |
| XLogP | 5.04 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|