C14H24FN — CID 91340707
3-ethylidene-6-fluoro-6-methyl-5-prop-1-en-2-yloctan-2-imine (PubChem CID 91340707) has the molecular formula C14H24FN and a molecular weight of 225.35 g/mol. Its IUPAC name is 3-ethylidene-6-fluoro-6-methyl-5-prop-1-en-2-yloctan-2-imine.
| Compound Name | 3-ethylidene-6-fluoro-6-methyl-5-prop-1-en-2-yloctan-2-imine |
|---|---|
| PubChem CID | 91340707 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | 3-ethylidene-6-fluoro-6-methyl-5-prop-1-en-2-yloctan-2-imine |
| SMILES | [H]/N=C(\C)C(=CC)CC(C(=C)C)C(C)(F)CC |
| InChI | InChI=1S/C14H24FN/c1-7-12(11(5)16)9-13(10(3)4)14(6,15)8-2/h7,13,16H,3,8-9H2,1-2,4-6H3/b12-7?,16-11+ |
| InChIKey | YJTLROKUOMKVTH-VSLBCYJVSA-N |
| XLogP | 4.69 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|