C16H26FN — CID 123416100
(6Z)-6-ethylidene-4-fluoro-5-heptan-3-yl-N-methylcyclohex-2-en-1-imine (PubChem CID 123416100) has the molecular formula C16H26FN and a molecular weight of 251.39 g/mol. Its IUPAC name is (6Z)-6-ethylidene-4-fluoro-5-heptan-3-yl-N-methylcyclohex-2-en-1-imine.
| Compound Name | (6Z)-6-ethylidene-4-fluoro-5-heptan-3-yl-N-methylcyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 123416100 |
| Molecular Formula | C16H26FN |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | (6Z)-6-ethylidene-4-fluoro-5-heptan-3-yl-N-methylcyclohex-2-en-1-imine |
| SMILES | C/C=C1C(=N\C)\C=CC(F)C\1C(CC)CCCC |
| InChI | InChI=1S/C16H26FN/c1-5-8-9-12(6-2)16-13(7-3)15(18-4)11-10-14(16)17/h7,10-12,14,16H,5-6,8-9H2,1-4H3/b13-7+,18-15+ |
| InChIKey | QFAFFXXTCJVTHL-CXTINALRSA-N |
| XLogP | 4.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|