C19H34F3N — CID 168907083
2-methylpropane;(E)-1,1,1-trifluoro-N,5-dimethyl-4-(4-methylcyclohexyl)hex-3-en-2-imine (PubChem CID 168907083) has the molecular formula C19H34F3N and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-methylpropane;(E)-1,1,1-trifluoro-N,5-dimethyl-4-(4-methylcyclohexyl)hex-3-en-2-imine.
| Compound Name | 2-methylpropane;(E)-1,1,1-trifluoro-N,5-dimethyl-4-(4-methylcyclohexyl)hex-3-en-2-imine |
|---|---|
| PubChem CID | 168907083 |
| Molecular Formula | C19H34F3N |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.26 |
| IUPAC Name | 2-methylpropane;(E)-1,1,1-trifluoro-N,5-dimethyl-4-(4-methylcyclohexyl)hex-3-en-2-imine |
| SMILES | C/N=C(/C=C(\C(C)C)C1CCC(C)CC1)C(F)(F)F.CC(C)C |
| InChI | InChI=1S/C15H24F3N.C4H10/c1-10(2)13(9-14(19-4)15(16,17)18)12-7-5-11(3)6-8-12;1-4(2)3/h9-12H,5-8H2,1-4H3;4H,1-3H3/b13-9+,19-14-; |
| InChIKey | SCMAOVSQTPURPN-XPTGSUNKSA-N |
| XLogP | 6.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|