C16H24F3N — CID 153339001
6-(3,4-dimethyl-3-propan-2-ylpent-4-enyl)-5-(trifluoromethyl)-2,3-dihydropyridine (PubChem CID 153339001) has the molecular formula C16H24F3N and a molecular weight of 287.37 g/mol. Its IUPAC name is 6-(3,4-dimethyl-3-propan-2-ylpent-4-enyl)-5-(trifluoromethyl)-2,3-dihydropyridine.
| Compound Name | 6-(3,4-dimethyl-3-propan-2-ylpent-4-enyl)-5-(trifluoromethyl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 153339001 |
| Molecular Formula | C16H24F3N |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 6-(3,4-dimethyl-3-propan-2-ylpent-4-enyl)-5-(trifluoromethyl)-2,3-dihydropyridine |
| SMILES | C=C(C)C(C)(CCC1=NCCC=C1C(F)(F)F)C(C)C |
| InChI | InChI=1S/C16H24F3N/c1-11(2)15(5,12(3)4)9-8-14-13(16(17,18)19)7-6-10-20-14/h7,12H,1,6,8-10H2,2-5H3 |
| InChIKey | KBOMASXESFMACR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|