C18H25F2N — CID 142357536
1-[6-(2-fluoro-3-methylhex-4-en-3-yl)cyclohexa-1,3-dien-1-yl]-N-[(E)-2-fluoroprop-1-enyl]ethanimine (PubChem CID 142357536) has the molecular formula C18H25F2N and a molecular weight of 293.40 g/mol. Its IUPAC name is 1-[6-(2-fluoro-3-methylhex-4-en-3-yl)cyclohexa-1,3-dien-1-yl]-N-[(E)-2-fluoroprop-1-enyl]ethanimine.
| Compound Name | 1-[6-(2-fluoro-3-methylhex-4-en-3-yl)cyclohexa-1,3-dien-1-yl]-N-[(E)-2-fluoroprop-1-enyl]ethanimine |
|---|---|
| PubChem CID | 142357536 |
| Molecular Formula | C18H25F2N |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-[6-(2-fluoro-3-methylhex-4-en-3-yl)cyclohexa-1,3-dien-1-yl]-N-[(E)-2-fluoroprop-1-enyl]ethanimine |
| SMILES | CC=CC(C)(C(C)F)C1CC=CC=C1/C(C)=N/C=C(\C)F |
| InChI | InChI=1S/C18H25F2N/c1-6-11-18(5,15(4)20)17-10-8-7-9-16(17)14(3)21-12-13(2)19/h6-9,11-12,15,17H,10H2,1-5H3/b11-6?,13-12+,21-14+ |
| InChIKey | BDVSYRPWTMGCOY-XLSFNIMSSA-N |
| XLogP | 5.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|