C21H30FN — CID 166852242
N-[(E)-2-fluoroprop-1-enyl]-3,5,5-trimethyl-9-pent-2-enylbicyclo[4.2.2]deca-1(8),6-dien-2-imine (PubChem CID 166852242) has the molecular formula C21H30FN and a molecular weight of 315.48 g/mol. Its IUPAC name is N-[(E)-2-fluoroprop-1-enyl]-3,5,5-trimethyl-9-pent-2-enylbicyclo[4.2.2]deca-1(8),6-dien-2-imine.
| Compound Name | N-[(E)-2-fluoroprop-1-enyl]-3,5,5-trimethyl-9-pent-2-enylbicyclo[4.2.2]deca-1(8),6-dien-2-imine |
|---|---|
| PubChem CID | 166852242 |
| Molecular Formula | C21H30FN |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | N-[(E)-2-fluoroprop-1-enyl]-3,5,5-trimethyl-9-pent-2-enylbicyclo[4.2.2]deca-1(8),6-dien-2-imine |
| SMILES | CCC=CCC1CC2=CC=C1/C(=N/C=C(\C)F)C(C)CC2(C)C |
| InChI | InChI=1S/C21H30FN/c1-6-7-8-9-17-12-18-10-11-19(17)20(23-14-16(3)22)15(2)13-21(18,4)5/h7-8,10-11,14-15,17H,6,9,12-13H2,1-5H3/b8-7?,16-14+,23-20+ |
| InChIKey | DKKMVDPJEGBPNB-XSRMHVFDSA-N |
| XLogP | 6.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|