C18H29F2N — CID 129066469
1-(4,4-difluorocyclohexyl)-N-[(Z)-2,4-dimethylpent-2-enyl]-3-methylbut-2-en-1-imine (PubChem CID 129066469) has the molecular formula C18H29F2N and a molecular weight of 297.43 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-N-[(Z)-2,4-dimethylpent-2-enyl]-3-methylbut-2-en-1-imine.
| Compound Name | 1-(4,4-difluorocyclohexyl)-N-[(Z)-2,4-dimethylpent-2-enyl]-3-methylbut-2-en-1-imine |
|---|---|
| PubChem CID | 129066469 |
| Molecular Formula | C18H29F2N |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-N-[(Z)-2,4-dimethylpent-2-enyl]-3-methylbut-2-en-1-imine |
| SMILES | CC(C)=C/C(=N\C/C(C)=C\C(C)C)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C18H29F2N/c1-13(2)10-15(5)12-21-17(11-14(3)4)16-6-8-18(19,20)9-7-16/h10-11,13,16H,6-9,12H2,1-5H3/b15-10-,21-17+ |
| InChIKey | OZAZAIYJYIBYBB-IQKYMNDRSA-N |
| XLogP | 5.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|