C21H37F2N — CID 170647063
(E)-5,5-difluoro-3-methyl-N-(2-methyl-3-pentylcyclohexen-1-yl)hex-3-en-2-imine;ethane (PubChem CID 170647063) has the molecular formula C21H37F2N and a molecular weight of 341.53 g/mol. Its IUPAC name is (E)-5,5-difluoro-3-methyl-N-(2-methyl-3-pentylcyclohexen-1-yl)hex-3-en-2-imine;ethane.
| Compound Name | (E)-5,5-difluoro-3-methyl-N-(2-methyl-3-pentylcyclohexen-1-yl)hex-3-en-2-imine;ethane |
|---|---|
| PubChem CID | 170647063 |
| Molecular Formula | C21H37F2N |
| Molecular Weight | 341.53 g/mol |
| Exact Mass | 341.29 |
| IUPAC Name | (E)-5,5-difluoro-3-methyl-N-(2-methyl-3-pentylcyclohexen-1-yl)hex-3-en-2-imine;ethane |
| SMILES | CC.CCCCCC1CCCC(/N=C(C)/C(C)=C/C(C)(F)F)=C1C |
| InChI | InChI=1S/C19H31F2N.C2H6/c1-6-7-8-10-17-11-9-12-18(15(17)3)22-16(4)14(2)13-19(5,20)21;1-2/h13,17H,6-12H2,1-5H3;1-2H3/b14-13+,22-16+; |
| InChIKey | RBCMMUYUOAHOSA-SYBIQCQHSA-N |
| XLogP | 7.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.53 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|