C22H33F2N — CID 178044043
N-[(4E)-6-cyclohexyl-5-ethenyl-2-methylhepta-2,4,6-trien-3-yl]-5,5-difluorohexan-2-imine (PubChem CID 178044043) has the molecular formula C22H33F2N and a molecular weight of 349.51 g/mol. Its IUPAC name is N-[(4E)-6-cyclohexyl-5-ethenyl-2-methylhepta-2,4,6-trien-3-yl]-5,5-difluorohexan-2-imine.
| Compound Name | N-[(4E)-6-cyclohexyl-5-ethenyl-2-methylhepta-2,4,6-trien-3-yl]-5,5-difluorohexan-2-imine |
|---|---|
| PubChem CID | 178044043 |
| Molecular Formula | C22H33F2N |
| Molecular Weight | 349.51 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | N-[(4E)-6-cyclohexyl-5-ethenyl-2-methylhepta-2,4,6-trien-3-yl]-5,5-difluorohexan-2-imine |
| SMILES | C=C/C(=C\C(/N=C(\C)CCC(C)(F)F)=C(C)C)C(=C)C1CCCCC1 |
| InChI | InChI=1S/C22H33F2N/c1-7-19(18(5)20-11-9-8-10-12-20)15-21(16(2)3)25-17(4)13-14-22(6,23)24/h7,15,20H,1,5,8-14H2,2-4,6H3/b19-15+,25-17+ |
| InChIKey | KTRDZZMZHLZVME-SNFOECCCSA-N |
| XLogP | 7.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.51 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|