About 3-ethyl-2,4-dimethyl-6-(trifluoromethyl)-4,5-dihydro-3H-indole
3-ethyl-2,4-dimethyl-6-(trifluoromethyl)-4,5-dihydro-3H-indole (PubChem CID 155258766) has the molecular formula C13H16F3N
and a molecular weight of 243.27 g/mol. Its IUPAC name is 3-ethyl-2,4-dimethyl-6-(trifluoromethyl)-4,5-dihydro-3H-indole.
Molecular Properties
| Compound Name | 3-ethyl-2,4-dimethyl-6-(trifluoromethyl)-4,5-dihydro-3H-indole |
| PubChem CID | 155258766 |
| Molecular Formula | C13H16F3N |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3-ethyl-2,4-dimethyl-6-(trifluoromethyl)-4,5-dihydro-3H-indole |
| SMILES | CCC1C(C)=NC2=C1C(C)CC(C(F)(F)F)=C2 |
| InChI | InChI=1S/C13H16F3N/c1-4-10-8(3)17-11-6-9(13(14,15)16)5-7(2)12(10)11/h6-7,10H,4-5H2,1-3H3 |
| InChIKey | VLCZUZBXGGPULM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-2,4-dimethyl-6-(trifluoromethyl)-4,5-dihydro-3H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,4-dimethyl-6-(trifluoromethyl)-4,5-dihydro-3H-indole?
The IUPAC name of 3-ethyl-2,4-dimethyl-6-(trifluoromethyl)-4,5-dihydro-3H-indole (CID 155258766) is 3-ethyl-2,4-dimethyl-6-(trifluoromethyl)-4,5-dihydro-3H-indole.
What is the SMILES notation for 3-ethyl-2,4-dimethyl-6-(trifluoromethyl)-4,5-dihydro-3H-indole?
The canonical SMILES for 3-ethyl-2,4-dimethyl-6-(trifluoromethyl)-4,5-dihydro-3H-indole is CCC1C(C)=NC2=C1C(C)CC(C(F)(F)F)=C2.
What is the InChIKey of 3-ethyl-2,4-dimethyl-6-(trifluoromethyl)-4,5-dihydro-3H-indole?
The InChIKey is VLCZUZBXGGPULM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3N/c1-4-10-8(3)17-11-6-9(13(14,15)16)5-7(2)12(10)11/h6-7,10H,4-5H2,1-3H3.
What are the key properties of 3-ethyl-2,4-dimethyl-6-(trifluoromethyl)-4,5-dihydro-3H-indole?
3-ethyl-2,4-dimethyl-6-(trifluoromethyl)-4,5-dihydro-3H-indole has a molecular weight of 243.27 g/mol, XLogP of 4.27, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,4-dimethyl-6-(trifluoromethyl)-4,5-dihydro-3H-indole is sourced from PubChem (CID 155258766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).