C19H31F2N — CID 170647064
(E)-5,5-difluoro-3-methyl-N-(2-methyl-3-pentylcyclohexen-1-yl)hex-3-en-2-imine (PubChem CID 170647064) has the molecular formula C19H31F2N and a molecular weight of 311.46 g/mol. Its IUPAC name is (E)-5,5-difluoro-3-methyl-N-(2-methyl-3-pentylcyclohexen-1-yl)hex-3-en-2-imine.
| Compound Name | (E)-5,5-difluoro-3-methyl-N-(2-methyl-3-pentylcyclohexen-1-yl)hex-3-en-2-imine |
|---|---|
| PubChem CID | 170647064 |
| Molecular Formula | C19H31F2N |
| Molecular Weight | 311.46 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | (E)-5,5-difluoro-3-methyl-N-(2-methyl-3-pentylcyclohexen-1-yl)hex-3-en-2-imine |
| SMILES | CCCCCC1CCCC(/N=C(C)/C(C)=C/C(C)(F)F)=C1C |
| InChI | InChI=1S/C19H31F2N/c1-6-7-8-10-17-11-9-12-18(15(17)3)22-16(4)14(2)13-19(5,20)21/h13,17H,6-12H2,1-5H3/b14-13+,22-16+ |
| InChIKey | QUYQGRPJHMDCPM-RWCCFGFOSA-N |
| XLogP | 6.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.46 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|