C18H32F2N2O2 — CID 11279441
2-amino-2-(difluoromethyl)-5-[(2-heptylcyclopentylidene)amino]pentanoic acid (PubChem CID 11279441) has the molecular formula C18H32F2N2O2 and a molecular weight of 346.46 g/mol. Its IUPAC name is 2-amino-2-(difluoromethyl)-5-[(2-heptylcyclopentylidene)amino]pentanoic acid.
| Compound Name | 2-amino-2-(difluoromethyl)-5-[(2-heptylcyclopentylidene)amino]pentanoic acid |
|---|---|
| PubChem CID | 11279441 |
| Molecular Formula | C18H32F2N2O2 |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 2-amino-2-(difluoromethyl)-5-[(2-heptylcyclopentylidene)amino]pentanoic acid |
| SMILES | CCCCCCCC1CCC/C1=N\CCCC(N)(C(=O)O)C(F)F |
| InChI | InChI=1S/C18H32F2N2O2/c1-2-3-4-5-6-9-14-10-7-11-15(14)22-13-8-12-18(21,16(19)20)17(23)24/h14,16H,2-13,21H2,1H3,(H,23,24)/b22-15+ |
| InChIKey | LSHKQPCIGKVUKW-PXLXIMEGSA-N |
| XLogP | 4.42 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|